On Target P2Y12_HUMAN 0.11570248/CHEMBL509456
For the given ligand test, we have found in our database that, being scored 0.11570248, the most similar ligand is CHEMBL509456. Check out the elaboration below.
| test (Given Ligand) | CHEMBL509456 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00010402 43040000 20020020 00100400 41080000 00000001 00000000 00000402 04208000 00144040 00001200 40023000 04038028 02840000 00010404 0008000c 14800000 00000000 00402080 00620001 40002001 00000a00 03008700 00200812 00218200 00000010 00404000 80000010 00001000 40140120 24820000 07010000 |