On Target DRD4_HUMAN 0.13513513/CHEMBL2112284
For the given ligand test, we have found in our database that, being scored 0.13513513, the most similar ligand is CHEMBL2112284. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2112284 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CC1(CCN(Cc2ccccc2)CC1)C(=O)\C=C(/O)\c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00028000 01000000 00100300 00010600 00000000 00004000 80000080 22001400 01800100 001208c0 00200000 50019800 86028886 00000000 00000402 00080008 00000400 02000000 00058000 00000201 00000000 18008320 00008020 00500010 01002000 c0000000 00446000 d0000000 00404100 00060000 64040000 00820200 |