On Target ACE_HUMAN 0.13043478/CHEMBL306556
For the given ligand test, we have found in our database that, being scored 0.13043478, the most similar ligand is CHEMBL306556. Check out the elaboration below.
| test (Given Ligand) | CHEMBL306556 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | OC(=O)[C@@H]1C=CCN1C(=O)CCS |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00000010 0000c000 01101000 00100400 00000080 08000000 00100040 00000400 00000040 00100000 00200a00 c0003000 02008102 00050000 80080004 00080008 30000000 00000100 00000000 00400200 40000000 10000e00 03008200 00000018 00000000 00000000 00480000 00000100 00000000 00040021 2c004000 03010200 |