On Target 5HT1B_HUMAN 0.14736842/CHEMBL70409
For the given ligand test, we have found in our database that, being scored 0.14736842, the most similar ligand is CHEMBL70409. Check out the elaboration below.
| test (Given Ligand) | CHEMBL70409 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | Cc1cc(ccc1CC2=NCCN2)C(C)(C)C |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00000004 00000000 00300100 00010600 00000021 00000000 10000000 00000000 00000180 20080843 18210010 40008800 00100042 00200008 00000000 00180008 00000a00 02000000 00000000 00200200 00200000 38200000 40004801 83400810 00000080 80000000 40000000 00000800 0c000010 00068002 40000000 00000600 |