On Target OPRD_HUMAN 0.15062761/CHEMBL1907788
For the given ligand test, we have found in our database that, being scored 0.15062761, the most similar ligand is CHEMBL1907788. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1907788 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CCN(CC)CC.CN([C@H](CN1CCCC1)c2cccc(NC(=O)C\N=C(/S)\N=C\3/C=CC(=C4c5ccc(O)cc5Oc6cc(O)ccc46)C(=C3)C(=O)O)c2)C(=O)Cc7ccc(Cl)c(Cl)c7 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 1800c003 84842008 60100328 84198680 44a01000 08000011 d60600c0 3300160a 01c000f4 00180ed3 88280214 4000b801 07028826 00183008 c1200447 0018600c 00040d00 42000010 18592094 02022a41 c4502415 78208f80 2180a001 87480838 81643080 e0110400 40563000 d4700080 0c408390 88060003 26072400 01232620 |