On Target PTGES_HUMAN 0.1744186/CHEMBL3770548
For the given ligand test, we have found in our database that, being scored 0.1744186, the most similar ligand is CHEMBL3770548. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3770548 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CC(C)C(=O)[C@]12C(=O)C(=C(O)[C@](CC=C(C)C)(C[C@@H](CC=C(C)C)[C@]1(C)CCC=C(C)C)C2=O)CC=C(C)C |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00010002 81000000 00800000 00200000 00090000 00000000 000000c0 00000402 01000140 00108000 00000000 40401000 94028028 00800000 00000400 00080408 00000000 00000020 02452000 0a022001 00000001 00000280 01008000 00000810 00200000 00000000 00404040 80000000 00004000 80000000 24020000 00000000 |