On Target EDNRA_HUMAN 0.5413534/CHEMBL64200
For the given ligand vs-17, we have found in our database that, being scored 0.5413534, the most similar ligand is CHEMBL64200. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL64200 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | O[C@]1(OC(=O)C(C1Cc2ccccc2)c3ccc4OCOc4c3)c5ccc(Cl)c(Cl)c5 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00058040 57000008 2000010a 00010b00 00281051 40004000 06040800 00000040 00200900 00080860 48100000 40009800 0700c0a6 20210000 c10c0001 022a9008 08820020 02000000 04480000 00020201 00050320 08000b20 01000040 00440010 40002400 80102000 001e0000 20010000 01800200 00020002 40202000 02430400 |