On Target GRM6_HUMAN 0.21186441/CHEMBL275079
For the given ligand vs-17, we have found in our database that, being scored 0.21186441, the most similar ligand is CHEMBL275079. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL275079 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | N[C@]1(CO[C@H]2[C@@H]([C@@H]12)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00070040 01000000 00000000 80010500 803c0040 00200000 00000000 00000000 00000000 01020080 00000000 4001b000 14008038 03800000 00081000 00081008 00a00000 00000100 11c02000 00000001 00000020 10000a00 03000000 00000010 10000400 00000000 00000200 00000000 00000200 00040000 00000000 00000000 |