On Target ACM5_HUMAN 0.42105263/CHEMBL3629534
For the given ligand vs-17, we have found in our database that, being scored 0.42105263, the most similar ligand is CHEMBL3629534. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3629534 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc(CCC(=O)OCC2(CCN(C)CC2)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000040 01000208 20100108 00010700 00101040 00000000 02040000 20000040 00000800 000808c0 08300000 50019000 04008002 00000000 01040001 000c1008 08020000 02000000 04400008 00020201 00010120 18000a00 01000040 00500010 00000c00 80000000 00120200 10000000 00000200 0006000a 00000000 00000e00 |