On Target CCR4_HUMAN 0.3188406/CHEMBL1907216
For the given ligand vs-17, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL1907216. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1907216 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | Brc1ccc(OCc2ccccc2)c(CNCC3CCCO3)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04004008 21008008 20100108 80010600 00081080 00004100 02000000 22001400 40000100 001008c0 08200000 c0018000 00800812 01010000 01081509 02082008 10000000 02008000 00400000 00020201 00000060 18008020 13008000 00d01010 10004400 c0002000 00420000 90000001 00000300 00060000 64040008 08000200 |