On Target HRH2_HUMAN 0.4122807/CHEMBL422931
For the given ligand vs-17, we have found in our database that, being scored 0.4122807, the most similar ligand is CHEMBL422931. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL422931 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | FC(F)(F)c1cc(COCC2(CCNCC2)c3ccccc3)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 010c0200 00100100 00010700 00100051 00004000 00000400 20000040 00000900 000808d0 08300000 50018002 00000002 01010000 00040000 020c1008 08000000 02000000 04400000 40000201 00010120 18000020 01000000 00400010 00000400 80002000 00080200 90000000 00000200 0006000a 40100004 02000e00 |