On Target CCR5_HUMAN 0.37323943/CHEMBL504250
For the given ligand vs-17, we have found in our database that, being scored 0.37323943, the most similar ligand is CHEMBL504250. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL504250 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | OCCOC(CCC1CCN(C[C@H]2CN(C[C@@H]2c3cccc(F)c3)[C@H](CC4CC4)C(=O)O)CC1)c5ccc(F)cc5 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00010000 01000600 80100102 02010700 00080090 00004010 00000000 20000000 00200980 000829e0 08300000 5003b000 0600800a 01a11000 80080000 020c9008 10800000 02000280 00402000 00100201 00000120 18200a30 07000000 89500010 00000400 80002000 80080000 10000021 04300202 0006801a 40024000 00002600 |