On Target NK2R_HUMAN 0.41447368/CHEMBL284269
For the given ligand vs-17, we have found in our database that, being scored 0.41447368, the most similar ligand is CHEMBL284269. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL284269 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CO\N=C(/COCc1cc(OC)c(OC)c(OC)c1)\C(CCN2CCC(O)(CC2)c3ccccc3)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00008001 4d000208 21100109 00010f00 00081010 00004000 46040040 20004002 00118940 000808c9 09310000 50018800 02004026 01010000 81000005 020c9018 00800000 02000004 00c80420 00220a01 80000120 18008120 410008c0 00548010 00002401 82102204 484e0000 10000000 00000200 0006000a 40080000 82022600 |