On Target MC4R_HUMAN 0.34126985/CHEMBL1501300
For the given ligand vs-17, we have found in our database that, being scored 0.34126985, the most similar ligand is CHEMBL1501300. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1501300 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc(CNCCc2ccc(Cl)cc2)cc1OCc3ccccc3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04008000 44000008 20100108 00210600 00001000 00004000 02040000 02001000 00000180 00080840 08200000 40008800 02804826 00010080 01000401 02088008 00000000 02000000 00480000 00020200 00000000 18208120 00000000 81c49010 00002000 c0002000 00260000 80000000 04000300 0006000a 60040000 00020600 |