On Target ADRB3_HUMAN 0.50427353/CHEMBL1086536
For the given ligand vs-17, we have found in our database that, being scored 0.50427353, the most similar ligand is CHEMBL1086536. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1086536 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc2cccc(O)c2 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 49000008 a0100100 00010700 00081091 00004000 02000000 20000840 00002180 000808c8 a8200000 40018000 00008002 00810000 00080000 0208b008 10800000 02000000 00402000 40020201 00000020 18200a30 07000000 89500010 00000400 80002000 005a0000 10000020 04000200 00060002 40000000 00002600 |