On Target ACM4_HUMAN 0.3895349/CHEMBL240022
For the given ligand vs-17, we have found in our database that, being scored 0.3895349, the most similar ligand is CHEMBL240022. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL240022 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cc2CCN(Cc2cc1OC)\C=N\c3ccc4CCCC(OC(=O)C)c4c3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 0000004a 47000808 2010010a 50010700 00081030 80004402 02140000 02001001 00400b80 01080852 18300004 44008820 0000c882 68210808 010004c1 02189008 00828a00 02000020 01492000 80020241 40022520 18208a20 23004010 81548010 000c0400 e8002201 403a0000 90000800 04400313 0086000a 60040000 00000600 |