On Target OPRK_HUMAN 0.53571427/CHEMBL2022021
For the given ligand vs-17, we have found in our database that, being scored 0.53571427, the most similar ligand is CHEMBL2022021. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL2022021 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C(=O)c4cccc(OC)c4 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00050040 43000808 2000010a 00010300 80281041 40000000 02000000 00000040 00000800 000a0840 08100000 4000d000 0400802a 20a00000 01044001 28081008 08820000 82000100 16482000 00020201 00010120 08020a00 01000000 00400014 00000400 80000000 00000000 00000000 00000202 00020002 80020000 02000400 |