On Target CXCR3_HUMAN 0.34228188/CHEMBL3920319
For the given ligand vs-17, we have found in our database that, being scored 0.34228188, the most similar ligand is CHEMBL3920319. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3920319 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CCCC(N(C)Cc1ccc(OCCN2C(=O)CCC2=O)c(OC)c1)c3ccc4OCCc4c3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04023000 45005008 2010010a 00210602 000010c1 02000010 12040000 22001240 00000800 000808c0 08300000 40009000 0480c802 00200000 010c1401 0208a018 18002000 02000000 04080400 00020201 00020100 18048600 13000000 00448018 00000000 c0000000 08b20000 90800005 00000302 0006000b 20040000 00800680 |