On Target ADA2B_HUMAN 0.39130434/CHEMBL1437
For the given ligand vs-17, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL1437. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1437 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | NC[C@H](O)c1ccc(O)c(O)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 4a000008 20000100 00010600 00000000 80004000 02000000 00000000 00000100 00080840 08000000 40008000 00000002 00000000 00000000 00088008 00000000 02000000 00000000 00020200 00000000 18000020 02000000 81400010 00000000 80000000 00520000 00000000 04000000 00060002 40000000 00000400 |