On Target ACM1_HUMAN 0.4368932/CHEMBL72506
For the given ligand vs-17, we have found in our database that, being scored 0.4368932, the most similar ligand is CHEMBL72506. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL72506 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CCN(CC)CCOCCOCC1(CCCC1)c2ccccc2 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 01000000 00000102 80010700 000800c0 00000000 00000000 00000040 00002800 00080840 08300000 40008000 00000002 00a00000 00041008 00099008 18800000 02000000 04402000 00000001 00010120 08000000 17000000 08400010 00000400 80000000 00000000 00000021 00000202 01060002 00000000 00000600 |