On Target CNR1_HUMAN 0.6/CHEMBL1923765
For the given ligand vs-17, we have found in our database that, being scored 0.6, the most similar ligand is CHEMBL1923765. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1923765 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CCCCCc1cc(O)cc(OCCCCCCOC(CO)CO)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000001 43000008 2000010a 00010300 00081000 42000000 42000000 00000000 00000800 00080840 08100000 40008000 00800002 20a00080 11000001 0008b008 00800000 02000000 01482000 00020a01 00000120 08000000 05000000 08400010 00000400 80000000 00000000 00000020 00010202 00020002 00000000 00000400 |