On Target GRM5_HUMAN 0.4385965/CHEMBL1682820
For the given ligand vs-17, we have found in our database that, being scored 0.4385965, the most similar ligand is CHEMBL1682820. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1682820 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | O=C1CCOc2cc(COc3ccccc3)ccc12 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 48000818 20000108 40050300 00001000 02224000 02000000 00000200 00000900 00080848 08100000 40009860 10808002 00010080 11000005 02082008 00000000 02008000 00480000 00020201 00000100 08020220 01000060 00c01014 00000000 c0002000 00000800 00000000 00000300 00020002 c0000000 00000400 |