On Target ACM3_HUMAN 0.45081967/CHEMBL1773265
For the given ligand vs-17, we have found in our database that, being scored 0.45081967, the most similar ligand is CHEMBL1773265. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1773265 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CC(C)N(CC[C@H](c1ccccc1)c2cc(CCCCOc3ccc(CCNC[C@H](O)c4ccc(O)c(O)c4)cc3)ccc2O)C(C)C |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 4b000208 2010010a 00010700 00081081 82004000 02040000 21000200 00000980 000808c0 08300000 40008240 00800002 00200000 11080001 000ca008 10800000 02000000 00400000 00020201 00000100 18200020 03000000 81400010 00000000 a0000000 00520000 50800000 04000280 0006800a 42000000 00002600 |