On Target 5HT1E_HUMAN 0.2651515/CHEMBL2391541
For the given ligand vs-17, we have found in our database that, being scored 0.2651515, the most similar ligand is CHEMBL2391541. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL2391541 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc2[nH]cc(CCN(CC=C)CC=C)c2c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000002 00000808 20100108 41010610 00041000 00000000 060c2000 00000400 00400080 00090840 08200004 40008000 10000806 00410000 01000041 0004000c 00000000 02000100 00200400 00020200 40000000 18208008 20800000 91400010 00042000 80000000 081a0000 00000020 04000200 00060002 04040200 02000620 |