On Target AGTR2_HUMAN 0.33742332/CHEMBL155987
For the given ligand vs-17, we have found in our database that, being scored 0.33742332, the most similar ligand is CHEMBL155987. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL155987 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cc2CN(C(Cc2cc1OCc3ccccc3)C(=O)O)C(=O)C(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04008008 46805008 20100108 10210600 000010a0 c0004000 03041000 03001004 00000980 00080840 08300000 4000b000 0780c882 20210080 c1080481 02088008 10000200 02000020 00480008 00020201 80020100 18208e20 03004040 81c49018 00000800 e0002001 00324000 c0000000 04000380 0086000b 60046000 00002600 |