On Target CXCR1_HUMAN 0.24623115/CHEMBL490688
For the given ligand vs-17, we have found in our database that, being scored 0.24623115, the most similar ligand is CHEMBL490688. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL490688 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c3ccc4OCCOc4c3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 14010002 46010888 20100109 01210e20 20001000 48020010 02040210 0a101600 00803900 00080851 88352004 4000c880 0a80c812 20100081 01240041 100ce00c 00040000 1a005000 08080012 10024201 41100100 18228f00 25010010 08458015 00840002 80800480 20320000 80800090 20408308 1006000b c6041000 00010600 |