On Target DRD4_HUMAN 0.49541286/CHEMBL3800303
For the given ligand vs-17, we have found in our database that, being scored 0.49541286, the most similar ligand is CHEMBL3800303. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3800303 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cc(CCNC[C@H](O)c2ccc(O)c(O)c2)ccc1OCCCc3ccccc3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 4a000008 20100108 00210700 00001080 82004000 02040000 00000000 00000980 00080840 08300000 40008000 00804002 20000000 11080001 0208a008 10000000 02000000 00480000 00020201 00000100 18200020 03000040 81400010 00000000 80000000 00520000 00000000 04000200 0006000a 40000000 00002640 |