On Target NPFF1_HUMAN 0.22560975/CHEMBL2208334
For the given ligand vs-17, we have found in our database that, being scored 0.22560975, the most similar ligand is CHEMBL2208334. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL2208334 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cccc(c1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)N |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00018000 45003a08 20100108 04010e00 00001000 00000000 02000000 2200300c 00200a80 000908c2 08300000 4003b000 06009812 00002001 81004401 20100008 00000000 02000000 00080008 00020201 00000100 38278620 00000003 8354801c 00000800 c0000000 40000000 90000000 0c000310 0006000b a00c4000 00002600 |