On Target 5HT1B_HUMAN 0.4108527/CHEMBL515472
For the given ligand vs-17, we have found in our database that, being scored 0.4108527, the most similar ligand is CHEMBL515472. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL515472 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1c(OCCF)cccc1[C@H](O)C2CCN(CCc3ccc(F)cc3)CC2 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 06000000 4b000008 2010010a 02210600 00101000 40004010 02000000 21000a00 00100980 000808c0 08300000 50018040 00804002 20201080 01000005 0208a008 00000000 02000080 00480400 00120201 00000100 18200020 01000000 81500410 00000000 c0000000 00000000 10000001 04000300 0006c00a 40004000 00002e00 |