On Target CXCR4_HUMAN 0.28323698/CHEMBL1644072
For the given ligand vs-17, we have found in our database that, being scored 0.28323698, the most similar ligand is CHEMBL1644072. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1644072 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc(CN(Cc2nc3ccccc3[nH]2)C4CCCc5cccnc45)c(CN)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 0000001a 45004008 2010490a 10810e10 00041160 00104000 03042000 22003003 00500900 000808c0 09318004 40818000 00000882 00600800 01020441 020c010c 00002200 06000006 00282408 00020201 40120100 18018020 21804000 00508010 00140000 c0000001 08224040 90000080 00400306 00c60802 60040000 20004680 |