On Target OPRX_HUMAN 0.4516129/CHEMBL3581755
For the given ligand vs-17, we have found in our database that, being scored 0.4516129, the most similar ligand is CHEMBL3581755. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3581755 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc(cc1)[C@@H](O)[C@@]2(C)C[C@]34CC[C@]2(OC)[C@@H]5Oc6c(O)ccc7C[C@H]3N(CC8CC8)CC[C@@]45c67 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04001000 43000208 2010050a 00210700 00381061 c2004002 02041000 20000241 00002990 010818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 17482002 00020201 00000100 18200030 05004040 89500410 00000000 c0000001 00520200 10800000 04000302 0007c80a 40020000 00002f40 |