On Target ACM2_HUMAN 0.47413793/CHEMBL74305
For the given ligand vs-17, we have found in our database that, being scored 0.47413793, the most similar ligand is CHEMBL74305. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL74305 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CCN(CC)CCOCCOC(=O)C1(CCCC1)c2ccc(OC)cc2 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00010000 01000008 2000050a 80010700 000810c0 00000000 02040000 00000040 00002800 00080840 08300000 40009000 0500800a 00a00000 41041009 00099008 18820000 02000000 04402000 00020001 00010120 08000a00 17000000 08400010 00000400 80000000 00120000 00000021 00000202 01060002 00002000 00000600 |