On Target HRH4_HUMAN 0.36/CHEMBL1934064
For the given ligand vs-17, we have found in our database that, being scored 0.36, the most similar ligand is CHEMBL1934064. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1934064 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc(OCCC[C@@H](N2CCC[C@@H]2C)c3ccc(cc3)c4ccc(CN5CCCCC5)cc4)cc1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04002000 01000008 2010010a 00010700 00181000 02000010 02000000 22001000 00000900 000808c0 08300000 50018800 80800802 00200000 11000401 00082008 00820000 02000000 04400000 10020201 00000100 18008000 11000000 00500010 00000000 c0000000 00080200 90000040 00004300 00060002 20040000 02002e00 |