On Target GRM4_HUMAN 0.24840765/CHEMBL3114673
For the given ligand vs-17, we have found in our database that, being scored 0.24840765, the most similar ligand is CHEMBL3114673. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3114673 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | N[C@@H](CCP(=O)(O)C(O)c1ccc(OCC(=O)O)cc1)C(=O)O |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 00000a08 20000108 00010600 00001000 00004000 02040000 84000000 00000140 00040840 00040001 4010f000 04808242 04060000 87298005 10080008 02001028 82300000 00410500 10020201 00000000 19500a20 07400000 28400010 00000000 82010002 03422008 00814000 60040200 10060300 50000000 0000d005 |