On Target BKRB2_HUMAN 0.23364486/CHEMBL130438
For the given ligand vs-17, we have found in our database that, being scored 0.23364486, the most similar ligand is CHEMBL130438. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL130438 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CN(C(=O)CNC(=O)CCCc1ccccc1)c2ccc(Cl)c(COc3cccn4c(Br)c(C)nc34)c2Cl |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 0403c002 0100a008 6010412a 14010610 04041060 04004024 41888000 28600008 00100900 00080ad0 09388004 4005b800 26808806 08b12401 c1060040 020c000c 08041000 92000000 08210004 c0020201 40101120 38008720 21802001 02d1911a 00046400 80082602 08088200 10040080 08428204 00460003 60044008 5ac20680 |