On Target HRH1_HUMAN 0.45038167/CHEMBL258930
For the given ligand vs-17, we have found in our database that, being scored 0.45038167, the most similar ligand is CHEMBL258930. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL258930 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | C1CO[C@H](CN1)[C@H](Oc2cccc3CCOc23)c4ccccc4 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04001000 42000208 20100108 80210600 000010c1 02004000 02000000 20000240 00002900 000808c0 08300000 40008000 00804002 20010080 012c1009 020da118 18200000 02000000 04c80002 00020201 00010120 18000020 17000080 08c01010 10000401 80002000 00000000 10800020 00000300 0006000a 40000000 00000740 |