On Target CCR2_HUMAN 0.38607594/CHEMBL3589844
For the given ligand vs-17, we have found in our database that, being scored 0.38607594, the most similar ligand is CHEMBL3589844. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL3589844 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc2c(CCOC23CCN(CCCC(=O)NCc4cc(F)cc(c4)C(F)(F)F)CC3)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00020040 43820208 20100508 02010600 00001051 00004012 12040400 22001041 00200900 000828d0 08300000 50039802 04008802 21291000 01040421 020c0008 08200000 02000000 04880002 00020201 80010120 18008620 01004080 00500018 00000401 c0002205 085a0000 90000001 00000301 0006880b 60140000 02802600 |