On Target OPRM_HUMAN 0.34745762/CHEMBL149074
For the given ligand Aspirin, we have found in our database that, being scored 0.34745762, the most similar ligand is CHEMBL149074. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL149074 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | O=C(Oc1ccc2C[C@@H]3[C@@H]4CCCC[C@]4(CCN3CC5CCC5)c2c1)c6ccc(cc6)C(=O)Oc7ccc8C[C@@H]9[C@@H]%10CCCC[C@]%10(CCN9CC%11CCC%11)c8c7 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04000000 43000a08 2010010a 40050600 00001020 40004002 02040000 20000001 00000980 000808c0 08300000 50818000 00808202 20210090 01010021 020c0008 00020200 02000000 02082000 00020201 00000100 18220a30 10004000 81d01014 00000000 80002001 00120000 10000000 04000202 0006000a c0020000 10002600 |