On Target HRH2_HUMAN 0.36296296/CHEMBL221462
For the given ligand Aspirin, we have found in our database that, being scored 0.36296296, the most similar ligand is CHEMBL221462. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL221462 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCOCCn1cc(C2CCN(CCOc3ccc(C)cc3C(=O)O)CC2)c4ccccc14 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04002002 01000a08 20100108 c081061a 00045281 00024000 02042000 20000800 00400900 000808c0 08300004 50018020 0a808802 00480800 01081041 080c600c 10200000 82828000 00200400 40020201 40000100 18068a38 32800000 84500014 00042400 80000000 08020a00 10000011 00000300 4006000a c0044200 00000620 |