On Target NK2R_HUMAN 0.4625/CHEMBL4111499
For the given ligand Aspirin, we have found in our database that, being scored 0.4625, the most similar ligand is CHEMBL4111499. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4111499 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCOc1cc(C=O)ccc1OCc2ccc(Cl)cc2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04008000 40000808 20000109 00210200 00001000 00004000 02040000 00000000 00000100 00000840 00000000 40008800 0280c086 00010080 01004001 22088008 00000000 02000000 00480000 00020200 00000000 08020320 00000000 00c01004 00002000 80002000 00060000 00000000 00000200 00020008 c0000000 00020000 |