On Target MC4R_HUMAN 0.32142857/CHEMBL205461
For the given ligand Aspirin, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL205461. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL205461 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCN(CC)CCCC(C)\N=C(\N)/NC(=O)c1cccc(F)c1OCc2cc(Br)ccc2OC |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04004040 43008808 20100108 02010e00 00001002 00024112 02010000 22003c00 40200100 00202ad2 19200010 d0038020 00808c12 00011008 01000021 02182008 00000800 02008000 00100000 00020201 00010040 38038620 0000a010 02d01014 00004000 80002001 40430800 90000001 0a008310 00068001 c4044008 88000200 |