On Target 5HT5A_HUMAN 0.30088496/CHEMBL363678
For the given ligand Aspirin, we have found in our database that, being scored 0.30088496, the most similar ligand is CHEMBL363678. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL363678 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCOc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04012008 01802008 20100108 04010602 00001080 00000000 02000000 22001008 00000100 000108c0 00200000 40019000 8480880a 00002000 01001401 00080008 10020000 02000000 04002000 10020205 80000000 38048e10 12000001 02500018 00000000 c0000000 00000000 90000041 08004300 01060001 20060000 00000200 |