On Target ACM1_HUMAN 0.4025974/CHEMBL4102555
For the given ligand Aspirin, we have found in our database that, being scored 0.4025974, the most similar ligand is CHEMBL4102555. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4102555 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1cccc(c1)C(=O)C[N+](C)(C)C.[O-]C=O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00000000 42000808 20100108 00010600 00001000 80000000 02000000 00000000 00000000 00080840 08200000 4000a000 00008002 20000000 01004001 20000008 00000000 02000000 00080000 00020200 00000000 18220a00 00000000 81400014 00000000 80000000 00000000 00000000 04000200 00060002 80004000 00000600 |