On Target 5HT1F_HUMAN 0.2631579/CHEMBL184994
For the given ligand Aspirin, we have found in our database that, being scored 0.2631579, the most similar ligand is CHEMBL184994. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL184994 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN1CCC(CC1)N2CCOc3ccc(NC(=O)c4ccc(F)cc4)cc23 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04006002 01000c08 20101108 02010602 a8001080 00000010 02000800 02001008 00000000 000009e0 002c0004 5001c000 00808822 00101000 012a1041 00084008 10040000 02000100 08000000 00120201 61100000 18068600 32412000 00508014 00080000 80100000 28040400 90000081 00808300 00068011 80040400 00000200 |