On Target NPBW1_HUMAN 0.25/CHEMBL1706758
For the given ligand Aspirin, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL1706758. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1706758 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CCOc1ccc(OC2=C(Cl)C=NN(C2=O)c3ccc(C)cc3)cc1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04010006 00000e08 60000108 00050600 00081018 0000c008 42040002 01001000 06100100 800108c0 01002004 78858800 8680880a 02a00000 01000041 010d200c 00040000 0200002c 00202110 40260000 40400080 1c018328 20800880 83700000 04101000 80008800 00080000 00200000 04000200 00460008 c0040400 82e20280 |