On Target 5HT1E_HUMAN 0.22522523/CHEMBL2391541
For the given ligand Aspirin, we have found in our database that, being scored 0.22522523, the most similar ligand is CHEMBL2391541. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL2391541 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1ccc2[nH]cc(CCN(CC=C)CC=C)c2c1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00000002 00000808 20100108 41010610 00041000 00000000 060c2000 00000400 00400080 00090840 08200004 40008000 10000806 00410000 01000041 0004000c 00000000 02000100 00200400 00020200 40000000 18208008 20800000 91400010 00042000 80000000 081a0000 00000020 04000200 00060002 04040200 02000620 |