On Target AA2AR_HUMAN 0.32786885/CHEMBL197359
For the given ligand Aspirin, we have found in our database that, being scored 0.32786885, the most similar ligand is CHEMBL197359. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL197359 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1ccc(CNC(=O)c2cnc3nc(C)ccc3c2O)cc1 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 10000002 01808808 20004108 10010610 00041020 00024000 06044000 02001400 00000100 00100840 41200004 40008800 00008802 00d00000 01020441 020c200c 00022000 0200000c 00200000 40060200 c0000000 08068e28 20800000 8040010c 00040000 c0000000 08220040 80000000 00400304 00460001 c4040000 80240280 |