On Target GRM2_HUMAN 0.39805827/CHEMBL3892611
For the given ligand Aspirin, we have found in our database that, being scored 0.39805827, the most similar ligand is CHEMBL3892611. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3892611 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CC(=O)c1ccc(OCc2ccc(Oc3cccc(c3)c4nn[nH]n4)cc2)c(C)c1O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04000001 40000818 60000109 01010200 00001001 00024008 42040000 00080200 00000100 00080840 08000000 40008000 00808082 00010000 01000001 0a08200c 00000000 02008800 00082000 00022a00 00460100 08020220 80008000 00c05014 00004000 80202000 10520000 00200000 00010384 00020002 c0000600 08000400 |