On Target MC5R_HUMAN 0.2847222/CHEMBL3932950
For the given ligand Aspirin, we have found in our database that, being scored 0.2847222, the most similar ligand is CHEMBL3932950. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3932950 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | NC(=N)NCCC[C@H]1N[C@@H](CNC(=O)c2ccc3ccccc3c2)CCN(CC(Oc4ccccc4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04012000 01007c08 20100108 04010e02 00001080 00004000 02000000 2200300c 00200380 000909e2 08200000 4003b000 06809812 00012001 81181401 02180008 10000000 02000000 00000000 00020201 08000000 382f8628 12000003 83d0101c 00000000 c0002000 40800000 90000001 0c000310 00060013 e00c4000 00002600 |