On Target HRH2_HUMAN 0.41484717/CHEMBL3104091
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.41484717, the most similar ligand is CHEMBL3104091. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL3104091 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CN1CCc2c(C1)c3cccc4CCc5ccccc5n2c34 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 1400000a 00005a00 00180120 10810610 00041021 00100000 10006000 02001000 00500900 00090ad0 09348004 40818800 80001882 00608a00 01020440 0a040004 00020208 8a800024 00200508 00000201 44020100 18308818 20804000 8b400414 00045800 c0080040 18000040 80000800 04000104 1086004a 200c8200 a0000720 |